cas: 914225-58-4 — see every product listed under this CAS number, including other names
4-Bromo-3-chloro-5-(trifluoromethyl)aniline, 96%, 96% (CAS 914225-58-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GRQ1-5g |
| cas | 914225-58-4 |
| size | 5g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 318.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-chloro-5-(trifluoromethyl)aniline (CAS 914225-58-4) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 4-bromo-3-chloro-5-(trifluoromethyl)aniline. InChIKey: WBGPOJPMDVJESG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 4-bromo-3-chloro-5-(trifluoromethyl)aniline |
| InChIKey | WBGPOJPMDVJESG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Br)Cl)N |
Computed by PubChem (NCBI)