cas: 89642-49-9 — see every product listed under this CAS number, including other names
4-Bromo-3-nitrobenzonitrile, 97%, 97% (CAS 89642-49-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KYJ-250mg |
| cas | 89642-49-9 |
| size | 250mg |
| availability | 550g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 482.00 Pln | |
| Chemat | 500g | 2169.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-nitrobenzonitrile (CAS 89642-49-9) is a chemical compound with the molecular formula C7H3BrN2O2 and a molecular weight of 227.01 g/mol. IUPAC name: 4-bromo-3-nitrobenzonitrile. InChIKey: FXRMUJPWDOLCLX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 4-bromo-3-nitrobenzonitrile |
| InChIKey | FXRMUJPWDOLCLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)