cas: 40292-15-7 — see every product listed under this CAS number, including other names
4-Bromo-4'-nitrobenzophenone 98% (CAS 40292-15-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A799966-10g |
| cas | 40292-15-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2033.56 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A799966 |
(4-bromophenyl)-(4-nitrophenyl)methanone (CAS 40292-15-7) is a chemical compound with the molecular formula C13H8BrNO3 and a molecular weight of 306.11 g/mol. IUPAC name: (4-bromophenyl)-(4-nitrophenyl)methanone. InChIKey: SXYMUGJXZKDIRK-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNO3 |
|---|---|
| Molecular weight | 306.11 g/mol |
| IUPAC name | (4-bromophenyl)-(4-nitrophenyl)methanone |
| InChIKey | SXYMUGJXZKDIRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)