CAS 62100-13-4 is the registry number for 4-Bromo-3'-nitrobenzophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(4-bromophenyl)-(3-nitrophenyl)methanone (CAS 62100-13-4) is a chemical compound with the molecular formula C13H8BrNO3 and a molecular weight of 306.11 g/mol. IUPAC name: (4-bromophenyl)-(3-nitrophenyl)methanone. InChIKey: LMPHOJDMACTBKY-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNO3 |
|---|---|
| Molecular weight | 306.11 g/mol |
| IUPAC name | (4-bromophenyl)-(3-nitrophenyl)methanone |
| InChIKey | LMPHOJDMACTBKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)