cas: 173312-36-2 — see every product listed under this CAS number, including other names
4-Bromo-5-methoxy-2-nitro-aniline, 96% (CAS 173312-36-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F719261-1G |
| cas | 173312-36-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1127.75 Pln | |
| Fluorochem | 10g | 1705.67 Pln | |
| Fluorochem | 25g | 4001.73 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
4-bromo-5-methoxy-2-nitroaniline (CAS 173312-36-2) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 4-bromo-5-methoxy-2-nitroaniline. InChIKey: JYXJPWNTXBYKMD-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 4-bromo-5-methoxy-2-nitroaniline |
| InChIKey | JYXJPWNTXBYKMD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)