cas: 99142-58-2 — see every product listed under this CAS number, including other names
4-Bromo-5-phenylfuran-2-carbaldehyde, ≥97%, ≥97% (CAS 99142-58-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEI1-250mg |
| cas | 99142-58-2 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 2094.80 Pln | |
| Chemat | 5g | 3309.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-5-phenylfuran-2-carbaldehyde (CAS 99142-58-2) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 4-bromo-5-phenylfuran-2-carbaldehyde. InChIKey: WIBVYLRIFQXHRW-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 4-bromo-5-phenylfuran-2-carbaldehyde |
| InChIKey | WIBVYLRIFQXHRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(O2)C=O)Br |
Computed by PubChem (NCBI)