CAS 16726-67-3 appears in our catalog under these names: 5-Bromo-1-naphthoic acid, 97%, 5-Bromo-1-naphthoic acid 98%, 5-Bromo-1-naphthoic acid, 98%, 98%, 5-Bromo-1-naphthoic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100g.
5-bromonaphthalene-1-carboxylic acid (CAS 16726-67-3) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 5-bromonaphthalene-1-carboxylic acid. InChIKey: SZFXXNVLSUTKJF-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 5-bromonaphthalene-1-carboxylic acid |
| InChIKey | SZFXXNVLSUTKJF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Br)C(=C1)C(=O)O |
Computed by PubChem (NCBI)