cas: 1784090-08-9 — see every product listed under this CAS number, including other names
4-Bromo-5-phenylthiazole-2-carbaldehyde, ≥95%, ≥95% (CAS 1784090-08-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEI6-100mg |
| cas | 1784090-08-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 707.60 Pln | |
| Chemat | 1g | 1542.80 Pln | |
| Chemat | 5g | 4130.00 Pln | |
| Chemat | 10g | 7091.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-5-phenyl-1,3-thiazole-2-carbaldehyde (CAS 1784090-08-9) is a chemical compound with the molecular formula C10H6BrNOS and a molecular weight of 268.13 g/mol. IUPAC name: 4-bromo-5-phenyl-1,3-thiazole-2-carbaldehyde. InChIKey: KUKFGLPJAQZFMX-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNOS |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 4-bromo-5-phenyl-1,3-thiazole-2-carbaldehyde |
| InChIKey | KUKFGLPJAQZFMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)C=O)Br |
Computed by PubChem (NCBI)