cas: 144631-82-3 — see every product listed under this CAS number, including other names
4-Bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine, 95% (CAS 144631-82-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F645734-100MG |
| cas | 144631-82-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 4683.79 Pln | |
| Fluorochem | 250mg | 6651.84 Pln | |
| Fluorochem | 1g | 13196.41 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine (CAS 144631-82-3) is a chemical compound with the molecular formula C8H4BrF3N2OS and a molecular weight of 313.10 g/mol. IUPAC name: 4-bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine. InChIKey: UGMJJOPHHBHLNL-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2OS |
|---|---|
| Molecular weight | 313.10 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| InChIKey | UGMJJOPHHBHLNL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)N)Br)OC(F)(F)F |
Computed by PubChem (NCBI)