CAS 144631-82-3 appears in our catalog under these names: Riluzole Impurity 7, 4-Bromo Riluzole, >95% (HPLC), 4-Bromo-6-(trifluoromethoxy)-2-benzothiazolamine (4-Bromoriluzole), 4-Bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine, 95%. Offered by: Chemat Brand, TRC, Mikromol, Fluorochem. Available pack sizes: on request, 100mg, 1g, 25mg, 250mg.
4-bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine (CAS 144631-82-3) is a chemical compound with the molecular formula C8H4BrF3N2OS and a molecular weight of 313.10 g/mol. IUPAC name: 4-bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine. InChIKey: UGMJJOPHHBHLNL-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2OS |
|---|---|
| Molecular weight | 313.10 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| InChIKey | UGMJJOPHHBHLNL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)N)Br)OC(F)(F)F |
Computed by PubChem (NCBI)