cas: 1227607-99-9 — see every product listed under this CAS number, including other names
4-Bromo-6-fluoroisoquinolin-1(2h)-one, 95% (CAS 1227607-99-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 100mg, 500mg, 2.5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-5053-5g |
| cas | 1227607-99-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 500mg | 627.92 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 2.5g | 2028.47 Pln | |
| Fluorochem | 5g | 2580.36 Pln | |
| Fluorochem | 10g | 5105.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromo-6-fluoro-2H-isoquinolin-1-one (CAS 1227607-99-9) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 4-bromo-6-fluoro-2H-isoquinolin-1-one. InChIKey: LLHQSKGXDXYXJD-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 4-bromo-6-fluoro-2H-isoquinolin-1-one |
| InChIKey | LLHQSKGXDXYXJD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CNC2=O)Br |
Computed by PubChem (NCBI)