CAS 1019016-29-5 is the registry number for 8-Bromo-6-fluoro-1,4-dihydroquinolin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
8-bromo-6-fluoro-1H-quinolin-4-one (CAS 1019016-29-5) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 8-bromo-6-fluoro-1H-quinolin-4-one. InChIKey: BZXSITKAJRDRIN-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 8-bromo-6-fluoro-1H-quinolin-4-one |
| InChIKey | BZXSITKAJRDRIN-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C1=O)C=C(C=C2Br)F |
Computed by PubChem (NCBI)