4-Bromo-7-chloroquinoline, 95%
cas: 98519-65-4 — see every product listed under this CAS number, including other names
4-Bromo-7-chloroquinoline, 95% (CAS 98519-65-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100g. Offered by: Combi-blocks, Ambeed, BLDpharm, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-5622-5g |
| cas | 98519-65-4 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 793.12 Pln | |
| Ambeed | 25g | 1877.81 Pln | |
| Ambeed | 100g | 6672.69 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 464.31 Pln | |
| BLDpharm | 10g | 853.06 Pln | |
| BLDpharm | 25g | 2019.31 Pln | |
| BLDpharm | 100g | 7189.72 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 25g | 1919.13 Pln | |
| Fluorochem | 100g | 6693.49 Pln | |
| Fluorochem | 10g | 810.15 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-bromo-7-chloroquinoline (CAS 98519-65-4) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 4-bromo-7-chloroquinoline. InChIKey: IVPHNMMNLBTDRQ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 4-bromo-7-chloroquinoline |
| InChIKey | IVPHNMMNLBTDRQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Cl)Br |
Computed by PubChem (NCBI)