4-Bromo-N-(4-nitrophenyl)-N-phenylaniline, 97%
cas: 1028385-91-2 — see every product listed under this CAS number, including other names
4-Bromo-N-(4-nitrophenyl)-N-phenylaniline, 97% (CAS 1028385-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1372806-100mg |
| cas | 1028385-91-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1627.50 Pln | |
| Ambeed | 5g | 5643.62 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 680.90 Pln | |
| BLDpharm | 1g | 1747.19 Pln | |
| BLDpharm | 5g | 6079.00 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1077.20 Pln | |
| Fluorochem | 100mg | 430.07 Pln | |
| Fluorochem | 250mg | 653.95 Pln | |
| Fluorochem | 1g | 1669.22 Pln | |
| Fluorochem | 5g | 5771.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
N-(4-bromophenyl)-4-nitro-N-phenylaniline (CAS 1028385-91-2) is a chemical compound with the molecular formula C18H13BrN2O2 and a molecular weight of 369.2 g/mol. IUPAC name: N-(4-bromophenyl)-4-nitro-N-phenylaniline. InChIKey: ZQHJNXTUZIUOQM-UHFFFAOYSA-N.
| Molecular formula | C18H13BrN2O2 |
|---|---|
| Molecular weight | 369.2 g/mol |
| IUPAC name | N-(4-bromophenyl)-4-nitro-N-phenylaniline |
| InChIKey | ZQHJNXTUZIUOQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)[N+](=O)[O-])C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)