Products 108446-73-7

CAS 108446-73-7 is the registry number for 3-[3-(4-Bromo-phenyl)-1-phenyl-1h-pyrazol-4-yl]-acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid (CAS 108446-73-7) is a chemical compound with the molecular formula C18H13BrN2O2 and a molecular weight of 369.2 g/mol. IUPAC name: (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid. InChIKey: QPKFCXWJIXKZHC-DHZHZOJOSA-N.

Identity
Molecular formulaC18H13BrN2O2
Molecular weight369.2 g/mol
IUPAC name(E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid
InChIKeyQPKFCXWJIXKZHC-DHZHZOJOSA-N
SMILESC1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(C=C3)Br)/C=C/C(=O)O

Computed by PubChem (NCBI)