4-Bromo-N-methyl-2-nitro-5-(trifluoromethyl)aniline, 90%
cas: 1007374-31-3 — see every product listed under this CAS number, including other names
4-Bromo-N-methyl-2-nitro-5-(trifluoromethyl)aniline, 90% (CAS 1007374-31-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1EXQCX-50mg |
| cas | 1007374-31-3 |
| size | 50mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 885.20 Pln | |
| Chemat | 100mg | 1125.20 Pln | |
| Chemat | 250mg | 1830.80 Pln | |
| Chemat | 1g | 3597.20 Pln | |
| Chemat | 5g | 10672.40 Pln | |
| Chemat | 10g | 17786.00 Pln | |
| Fluorochem | 50mg | 1153.78 Pln | |
| Fluorochem | 100mg | 1481.79 Pln | |
| Fluorochem | 250mg | 2398.13 Pln | |
| Fluorochem | 1g | 4704.61 Pln | |
| Fluorochem | 5g | 13722.27 Pln | |
| Fluorochem | 10g | 22864.88 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
4-bromo-N-methyl-2-nitro-5-(trifluoromethyl)aniline (CAS 1007374-31-3) is a chemical compound with the molecular formula C8H6BrF3N2O2 and a molecular weight of 299.04 g/mol. IUPAC name: 4-bromo-N-methyl-2-nitro-5-(trifluoromethyl)aniline. InChIKey: GUTSNDVVFYEXSC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3N2O2 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 4-bromo-N-methyl-2-nitro-5-(trifluoromethyl)aniline |
| InChIKey | GUTSNDVVFYEXSC-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C(=C1)C(F)(F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)