cas: 53484-26-7 — see every product listed under this CAS number, including other names
4-Bromo-N-methyl-2-nitroaniline, 95% (CAS 53484-26-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211459-1G |
| cas | 53484-26-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 25g | 846.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-N-methyl-2-nitroaniline (CAS 53484-26-7) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 4-bromo-N-methyl-2-nitroaniline. InChIKey: IFTUKVAJYOQKRS-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 4-bromo-N-methyl-2-nitroaniline |
| InChIKey | IFTUKVAJYOQKRS-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)