cas: 213627-30-6 — see every product listed under this CAS number, including other names
4-Bromobenzylmethylsulfone, 97% (CAS 213627-30-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024347-1G |
| cas | 213627-30-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 534.20 Pln | |
| Fluorochem | 25g | 924.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-bromo-4-(methylsulfonylmethyl)benzene (CAS 213627-30-6) is a chemical compound with the molecular formula C8H9BrO2S and a molecular weight of 249.13 g/mol. IUPAC name: 1-bromo-4-(methylsulfonylmethyl)benzene. InChIKey: CCSFLRBJHQPXFL-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO2S |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 1-bromo-4-(methylsulfonylmethyl)benzene |
| InChIKey | CCSFLRBJHQPXFL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)