cas: 136239-68-4 — see every product listed under this CAS number, including other names
4-Butoxy-2,3-difluorophenol 97% (CAS 136239-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A572348-100mg |
| cas | 136239-68-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 1833.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A572348 |
4-butoxy-2,3-difluorophenol (CAS 136239-68-4) is a chemical compound with the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. IUPAC name: 4-butoxy-2,3-difluorophenol. InChIKey: HQFTTYLLNVHBGT-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O2 |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | 4-butoxy-2,3-difluorophenol |
| InChIKey | HQFTTYLLNVHBGT-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C(=C(C=C1)O)F)F |
Computed by PubChem (NCBI)