Products 1394937-93-9
CAS 1394937-93-9 appears in our catalog under these names: 1,2-Difluoro-4-isopropoxy-3-methoxybenzene, 95%, 1,2-Difluoro-4-isopropoxy-3-methoxybenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1,2-difluoro-3-methoxy-4-propan-2-yloxybenzene (CAS 1394937-93-9) is a chemical compound with the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. IUPAC name: 1,2-difluoro-3-methoxy-4-propan-2-yloxybenzene. InChIKey: GVTYYZPWMZZGEJ-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O2 |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | 1,2-difluoro-3-methoxy-4-propan-2-yloxybenzene |
| InChIKey | GVTYYZPWMZZGEJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)F)F)OC |
Computed by PubChem (NCBI)