cas: 26227-73-6 — see every product listed under this CAS number, including other names
4-Butyl-N-(4-methoxybenzylidene)aniline 98% (CAS 26227-73-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A437245-1g |
| cas | 26227-73-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 565.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A437245 |
N-(4-butylphenyl)-1-(4-methoxyphenyl)methanimine (CAS 26227-73-6) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: N-(4-butylphenyl)-1-(4-methoxyphenyl)methanimine. InChIKey: FEIWNULTQYHCDN-UHFFFAOYSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | N-(4-butylphenyl)-1-(4-methoxyphenyl)methanimine |
| InChIKey | FEIWNULTQYHCDN-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)