cas: 26227-73-6 — see every product listed under this CAS number, including other names
4-Butyl-N-(4-methoxybenzylidene)aniline, 98%, 98% (CAS 26227-73-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RGI-1g |
| cas | 26227-73-6 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 491.60 Pln | |
| Chemat | 50g | 856.40 Pln | |
| Chemat | 100g | 1442.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(4-butylphenyl)-1-(4-methoxyphenyl)methanimine (CAS 26227-73-6) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: N-(4-butylphenyl)-1-(4-methoxyphenyl)methanimine. InChIKey: FEIWNULTQYHCDN-UHFFFAOYSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | N-(4-butylphenyl)-1-(4-methoxyphenyl)methanimine |
| InChIKey | FEIWNULTQYHCDN-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)