cas: 69747-68-8 — see every product listed under this CAS number, including other names
4-CHLORODIBENZO[B,D]THIOPHENE, 95%, 95% (CAS 69747-68-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBZB-100mg |
| cas | 69747-68-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-chlorodibenzothiophene (CAS 69747-68-8) is a chemical compound with the molecular formula C12H7ClS and a molecular weight of 218.70 g/mol. IUPAC name: 4-chlorodibenzothiophene. InChIKey: HGRZBGFNEVHNDV-UHFFFAOYSA-N.
| Molecular formula | C12H7ClS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 4-chlorodibenzothiophene |
| InChIKey | HGRZBGFNEVHNDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=CC=C3)Cl |
Computed by PubChem (NCBI)