CAS 69747-68-8 appears in our catalog under these names: 4-Chlorodibenzothiophene, 95%, 4-CHLORODIBENZO[B,D]THIOPHENE, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
4-chlorodibenzothiophene (CAS 69747-68-8) is a chemical compound with the molecular formula C12H7ClS and a molecular weight of 218.70 g/mol. IUPAC name: 4-chlorodibenzothiophene. InChIKey: HGRZBGFNEVHNDV-UHFFFAOYSA-N.
| Molecular formula | C12H7ClS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 4-chlorodibenzothiophene |
| InChIKey | HGRZBGFNEVHNDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=CC=C3)Cl |
Computed by PubChem (NCBI)