cas: 59855-11-7 — see every product listed under this CAS number, including other names
4-Carbamimidoylbenzamide hydrochloride, 95%, 95% (CAS 59855-11-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KNA-1g |
| cas | 59855-11-7 |
| size | 1g |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 443.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-carbamimidoylbenzamide;hydrochloride (CAS 59855-11-7) is a chemical compound with the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. IUPAC name: 4-carbamimidoylbenzamide;hydrochloride. InChIKey: IYIAWOSYBLPUNL-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O |
|---|---|
| Molecular weight | 199.64 g/mol |
| IUPAC name | 4-carbamimidoylbenzamide;hydrochloride |
| InChIKey | IYIAWOSYBLPUNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)C(=O)N.Cl |
Computed by PubChem (NCBI)