cas: 850589-52-5 — see every product listed under this CAS number, including other names
4-Carbamoyl-3-chlorophenylboronic acid, 96%, 96% (CAS 850589-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115YHM-100mg |
| cas | 850589-52-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 506.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(4-carbamoyl-3-chlorophenyl)boronic acid (CAS 850589-52-5) is a chemical compound with the molecular formula C7H7BClNO3 and a molecular weight of 199.40 g/mol. IUPAC name: (4-carbamoyl-3-chlorophenyl)boronic acid. InChIKey: ZARZNNIZDSRQFA-UHFFFAOYSA-N.
| Molecular formula | C7H7BClNO3 |
|---|---|
| Molecular weight | 199.40 g/mol |
| IUPAC name | (4-carbamoyl-3-chlorophenyl)boronic acid |
| InChIKey | ZARZNNIZDSRQFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N)Cl)(O)O |
Computed by PubChem (NCBI)