cas: 2121513-72-0 — see every product listed under this CAS number, including other names
4-Carboxy-3-(trifluoromethyl)phenylboronic acid pinacol ester, 98%, 98% (CAS 2121513-72-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12SS9U-250mg |
| cas | 2121513-72-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1466.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoic acid (CAS 2121513-72-0) is a chemical compound with the molecular formula C14H16BF3O4 and a molecular weight of 316.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoic acid. InChIKey: WGMLHOOENBAYCN-UHFFFAOYSA-N.
| Molecular formula | C14H16BF3O4 |
|---|---|
| Molecular weight | 316.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzoic acid |
| InChIKey | WGMLHOOENBAYCN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)