cas: 13602-12-5 — see every product listed under this CAS number, including other names
4-Carboxypyridine 1-oxide 98% (CAS 13602-12-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294315-5g |
| cas | 13602-12-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 453.81 Pln | |
| Ambeed | 500g | 1605.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A294315 |
Isonicotinic acid N-oxide is a member of pyridines and an aromatic carboxylic acid.
Source: ChEBI
| Molecular formula | C6H5NO3 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-4-carboxylic acid |
| InChIKey | QCWTWMJMLSKQCJ-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(=O)O)[O-] |
Computed by PubChem (NCBI)