CAS 192804-36-7 appears in our catalog under these names: 4–Cbz–aminophenylboronic acid (contains varying amounts of Anhydride), 4-(Benzyloxycarbonylamino)phenylboronic Acid (contains varying amounts of Anhydride), (4-(((Benzyloxy)carbonyl)amino)phenyl)boronic acid, 98%, 98%, (4-(((Benzyloxy)carbonyl)amino)phenyl)boronic acid, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 250mg, 10g.
[4-(phenylmethoxycarbonylamino)phenyl]boronic acid (CAS 192804-36-7) is a chemical compound with the molecular formula C14H14BNO4 and a molecular weight of 271.08 g/mol. IUPAC name: [4-(phenylmethoxycarbonylamino)phenyl]boronic acid. InChIKey: KYCQBMOJDXVNIC-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO4 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | [4-(phenylmethoxycarbonylamino)phenyl]boronic acid |
| InChIKey | KYCQBMOJDXVNIC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)