cas: 1256360-42-5 — see every product listed under this CAS number, including other names
4-Chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 96% (CAS 1256360-42-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694310-250MG |
| cas | 1256360-42-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 4163.14 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 1256360-42-5) is a chemical compound with the molecular formula C15H19BClNO2 and a molecular weight of 291.6 g/mol. IUPAC name: 4-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: VUBGUQRJVLABQU-UHFFFAOYSA-N.
| Molecular formula | C15H19BClNO2 |
|---|---|
| Molecular weight | 291.6 g/mol |
| IUPAC name | 4-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | VUBGUQRJVLABQU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C)C=CC=C3Cl |
Computed by PubChem (NCBI)