CAS 1073353-82-8 appears in our catalog under these names: 6-Chloro-1-methylindole-2-boronic acid, pinacol ester, 95%, 6-Chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 98%, 6-Chloro-1-methylindole-2-boronic acid, pinacol ester, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 1073353-82-8) is a chemical compound with the molecular formula C15H19BClNO2 and a molecular weight of 291.6 g/mol. IUPAC name: 6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: XSLOXVSTSLRQFE-UHFFFAOYSA-N.
| Molecular formula | C15H19BClNO2 |
|---|---|
| Molecular weight | 291.6 g/mol |
| IUPAC name | 6-chloro-1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | XSLOXVSTSLRQFE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C)C=C(C=C3)Cl |
Computed by PubChem (NCBI)