cas: 935466-70-9 — see every product listed under this CAS number, including other names
4-Chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile 97% (CAS 935466-70-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A496629-250mg |
| cas | 935466-70-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2361.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A496629 |
4-chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile (CAS 935466-70-9) is a chemical compound with the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. IUPAC name: 4-chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile. InChIKey: YJJYGYGAVOSCNG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3 |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | 4-chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile |
| InChIKey | YJJYGYGAVOSCNG-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC(=CC(=C21)Cl)C#N |
Computed by PubChem (NCBI)