cas: 935466-70-9 — see every product listed under this CAS number, including other names
4-Chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile, 98%, 98% (CAS 935466-70-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GU0Z-100mg |
| cas | 935466-70-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1883.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile (CAS 935466-70-9) is a chemical compound with the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. IUPAC name: 4-chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile. InChIKey: YJJYGYGAVOSCNG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3 |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | 4-chloro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile |
| InChIKey | YJJYGYGAVOSCNG-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC(=CC(=C21)Cl)C#N |
Computed by PubChem (NCBI)