4-Chloro-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridine, 97%
cas: 878232-70-3 — see every product listed under this CAS number, including other names
4-Chloro-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridine, 97% (CAS 878232-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A593465-100mg |
| cas | 878232-70-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1627.50 Pln | |
| Ambeed | 250mg | 2712.19 Pln | |
| Ambeed | 1g | 7190.00 Pln | |
| Chemat | 50mg | 909.20 Pln | |
| Chemat | 100mg | 1499.60 Pln | |
| Chemat | 250mg | 2502.80 Pln | |
| BLDpharm | 50mg | 964.13 Pln | |
| BLDpharm | 100mg | 1591.69 Pln | |
| BLDpharm | 250mg | 2657.98 Pln | |
| BLDpharm | 1g | 7056.43 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridine (CAS 878232-70-3) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 180.63 g/mol. IUPAC name: 4-chloro-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridine. InChIKey: WPJWHKZVPLCYFL-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 4-chloro-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridine |
| InChIKey | WPJWHKZVPLCYFL-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=NC=C2)Cl)C |
Computed by PubChem (NCBI)