CAS 108244-44-6 appears in our catalog under these names: 2-Chloro-6-isopropylnicotinonitrile, 2-Chloro-6-isopropylnicotinonitrile, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 250mg, 1g.
2-chloro-6-propan-2-ylpyridine-3-carbonitrile (CAS 108244-44-6) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 180.63 g/mol. IUPAC name: 2-chloro-6-propan-2-ylpyridine-3-carbonitrile. InChIKey: KZXQCYPAMGNZPE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 2-chloro-6-propan-2-ylpyridine-3-carbonitrile |
| InChIKey | KZXQCYPAMGNZPE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)