cas: 59886-90-7 — see every product listed under this CAS number, including other names
4-Chloro-2,3-dimethylpyridine 1-oxide, 98%, 98% (CAS 59886-90-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAML-5g |
| cas | 59886-90-7 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 294.80 Pln | |
| Chemat | 100g | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium (CAS 59886-90-7) is a chemical compound with the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. IUPAC name: 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium. InChIKey: MCUYHRNUDDANSO-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO |
|---|---|
| Molecular weight | 157.60 g/mol |
| IUPAC name | 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium |
| InChIKey | MCUYHRNUDDANSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C)[O-])Cl |
Computed by PubChem (NCBI)