CAS 59886-90-7 appears in our catalog under these names: 4-Chloro-2,3-dimethylpyridine 1-oxide, 97%, Rabeprazole Impurity 16, 4-Chloro-2,3-dimethylpyridine N-Oxide, >95% (HPLC), 4-Chloro-2,3-dimethylpyridine N-Oxide, 4–Chloro–2,3–dimethylpyridine N–Oxide. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 25g, 5g, 100g, 1g, on request, 4x25mg, 25mg, 50g.
4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium (CAS 59886-90-7) is a chemical compound with the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. IUPAC name: 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium. InChIKey: MCUYHRNUDDANSO-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO |
|---|---|
| Molecular weight | 157.60 g/mol |
| IUPAC name | 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium |
| InChIKey | MCUYHRNUDDANSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C)[O-])Cl |
Computed by PubChem (NCBI)