4-Chloro-2-fluoro-5-iodobenzoic acid, 97%
cas: 1440526-33-9 — see every product listed under this CAS number, including other names
4-Chloro-2-fluoro-5-iodobenzoic acid, 97% (CAS 1440526-33-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F667790-250MG |
| cas | 1440526-33-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2523.09 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 635.60 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 369.89 Pln | |
| BLDpharm | 1g | 814.18 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-chloro-2-fluoro-5-iodobenzoic acid (CAS 1440526-33-9) is a chemical compound with the molecular formula C7H3ClFIO2 and a molecular weight of 300.45 g/mol. IUPAC name: 4-chloro-2-fluoro-5-iodobenzoic acid. InChIKey: ADPSZAFEYOAEJJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFIO2 |
|---|---|
| Molecular weight | 300.45 g/mol |
| IUPAC name | 4-chloro-2-fluoro-5-iodobenzoic acid |
| InChIKey | ADPSZAFEYOAEJJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)Cl)F)C(=O)O |
Computed by PubChem (NCBI)