CAS 264927-52-8 appears in our catalog under these names: 2–Chloro–4–fluoro–5–iodobenzoic acid, 2-Chloro-4-fluoro-5-iodobenzoic acid 95%, 2-Chloro-4-fluoro-5-iodobenzoic acid, 95%, 95%, 2-Chloro-4-fluoro-5-iodobenzoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
2-chloro-4-fluoro-5-iodobenzoic acid (CAS 264927-52-8) is a chemical compound with the molecular formula C7H3ClFIO2 and a molecular weight of 300.45 g/mol. IUPAC name: 2-chloro-4-fluoro-5-iodobenzoic acid. InChIKey: PXQFJWCRWMFMEG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFIO2 |
|---|---|
| Molecular weight | 300.45 g/mol |
| IUPAC name | 2-chloro-4-fluoro-5-iodobenzoic acid |
| InChIKey | PXQFJWCRWMFMEG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)F)Cl)C(=O)O |
Computed by PubChem (NCBI)