cas: 886497-43-4 — see every product listed under this CAS number, including other names
4-Chloro-3-(3-chlorophenyl)-5,6H-pyradazin-6-one (CAS 886497-43-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023490-1G |
| cas | 886497-43-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 10g | 4095.45 Pln |
| delivery time | 2-3 weeks |
|---|
4-chloro-3-(3-chlorophenyl)-1H-pyridazin-6-one (CAS 886497-43-4) is a chemical compound with the molecular formula C10H6Cl2N2O and a molecular weight of 241.07 g/mol. IUPAC name: 4-chloro-3-(3-chlorophenyl)-1H-pyridazin-6-one. InChIKey: UQAHTZKJQBMATM-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 4-chloro-3-(3-chlorophenyl)-1H-pyridazin-6-one |
| InChIKey | UQAHTZKJQBMATM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NNC(=O)C=C2Cl |
Computed by PubChem (NCBI)