Products 886497-43-4
CAS 886497-43-4 appears in our catalog under these names: 5-Chloro-6-(3-chlorophenyl)pyridazin-3(2h)-one, 95%, 4-Chloro-3-(3-chlorophenyl)-5,6H-pyradazin-6-one, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 10g.
4-chloro-3-(3-chlorophenyl)-1H-pyridazin-6-one (CAS 886497-43-4) is a chemical compound with the molecular formula C10H6Cl2N2O and a molecular weight of 241.07 g/mol. IUPAC name: 4-chloro-3-(3-chlorophenyl)-1H-pyridazin-6-one. InChIKey: UQAHTZKJQBMATM-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 4-chloro-3-(3-chlorophenyl)-1H-pyridazin-6-one |
| InChIKey | UQAHTZKJQBMATM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NNC(=O)C=C2Cl |
Computed by PubChem (NCBI)