cas: 871332-65-9 — see every product listed under this CAS number, including other names
4-Chloro-3-(N-methylcarbamoyl)phenylboronic acid, 97% (CAS 871332-65-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219379-250MG |
| cas | 871332-65-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 893.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-chloro-3-(methylcarbamoyl)phenyl]boronic acid (CAS 871332-65-9) is a chemical compound with the molecular formula C8H9BClNO3 and a molecular weight of 213.43 g/mol. IUPAC name: [4-chloro-3-(methylcarbamoyl)phenyl]boronic acid. InChIKey: SYZZWFMATUWETK-UHFFFAOYSA-N.
| Molecular formula | C8H9BClNO3 |
|---|---|
| Molecular weight | 213.43 g/mol |
| IUPAC name | [4-chloro-3-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | SYZZWFMATUWETK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)NC)(O)O |
Computed by PubChem (NCBI)