CAS 1451391-89-1 appears in our catalog under these names: B-[2-Chloro-4-[(methylamino)carbonyl]phenyl]boronic acid, ≥95%, ≥95%, 2-Chloro-4-(methylcarbamoyl)phenylboronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
[2-chloro-4-(methylcarbamoyl)phenyl]boronic acid (CAS 1451391-89-1) is a chemical compound with the molecular formula C8H9BClNO3 and a molecular weight of 213.43 g/mol. IUPAC name: [2-chloro-4-(methylcarbamoyl)phenyl]boronic acid. InChIKey: LSMHGCJWZPHACP-UHFFFAOYSA-N.
| Molecular formula | C8H9BClNO3 |
|---|---|
| Molecular weight | 213.43 g/mol |
| IUPAC name | [2-chloro-4-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | LSMHGCJWZPHACP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NC)Cl)(O)O |
Computed by PubChem (NCBI)