4-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid, 96%
cas: 350488-79-8 — see every product listed under this CAS number, including other names
4-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid, 96% (CAS 350488-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A697896-100mg |
| cas | 350488-79-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 25g | 1471.75 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 375.45 Pln | |
| BLDpharm | 25g | 1430.63 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-3-nitro-5-(trifluoromethyl)benzoic acid (CAS 350488-79-8) is a chemical compound with the molecular formula C8H3ClF3NO4 and a molecular weight of 269.56 g/mol. IUPAC name: 4-chloro-3-nitro-5-(trifluoromethyl)benzoic acid. InChIKey: QMHLEMNSBVDXQD-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO4 |
|---|---|
| Molecular weight | 269.56 g/mol |
| IUPAC name | 4-chloro-3-nitro-5-(trifluoromethyl)benzoic acid |
| InChIKey | QMHLEMNSBVDXQD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)