4-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid, 97%
cas: 350488-79-8 — see every product listed under this CAS number, including other names
4-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid, 97% (CAS 350488-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch118GE0-100mg |
| cas | 350488-79-8 |
| size | 100mg |
| availability | 15g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 299.60 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 716.43 Pln | |
| Fluorochem | 25g | 1523.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-3-nitro-5-(trifluoromethyl)benzoic acid (CAS 350488-79-8) is a chemical compound with the molecular formula C8H3ClF3NO4 and a molecular weight of 269.56 g/mol. IUPAC name: 4-chloro-3-nitro-5-(trifluoromethyl)benzoic acid. InChIKey: QMHLEMNSBVDXQD-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO4 |
|---|---|
| Molecular weight | 269.56 g/mol |
| IUPAC name | 4-chloro-3-nitro-5-(trifluoromethyl)benzoic acid |
| InChIKey | QMHLEMNSBVDXQD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)