cas: 428871-64-1 — see every product listed under this CAS number, including other names
4-Chloro-5-fluoro-2-nitroaniline 97% (CAS 428871-64-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A168899-250mg |
| cas | 428871-64-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1683.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A168899 |
4-chloro-5-fluoro-2-nitroaniline (CAS 428871-64-1) is a chemical compound with the molecular formula C6H4ClFN2O2 and a molecular weight of 190.56 g/mol. IUPAC name: 4-chloro-5-fluoro-2-nitroaniline. InChIKey: IVUBVUIBVDTNAT-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFN2O2 |
|---|---|
| Molecular weight | 190.56 g/mol |
| IUPAC name | 4-chloro-5-fluoro-2-nitroaniline |
| InChIKey | IVUBVUIBVDTNAT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)