CAS 1482558-25-7 is the registry number for 4-Chloro-2-fluoro-6-nitroaniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-chloro-2-fluoro-6-nitroaniline (CAS 1482558-25-7) is a chemical compound with the molecular formula C6H4ClFN2O2 and a molecular weight of 190.56 g/mol. IUPAC name: 4-chloro-2-fluoro-6-nitroaniline. InChIKey: HQJZMWXNKCKFBX-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFN2O2 |
|---|---|
| Molecular weight | 190.56 g/mol |
| IUPAC name | 4-chloro-2-fluoro-6-nitroaniline |
| InChIKey | HQJZMWXNKCKFBX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)F)Cl |
Computed by PubChem (NCBI)