cas: 321432-82-0 — see every product listed under this CAS number, including other names
4-Chloro-5-methoxy-2-(pyridin-2-yl)pyrimidine 95% (CAS 321432-82-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181656-100mg |
| cas | 321432-82-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 2089.19 Pln | |
| Ambeed | 5g | 6094.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A181656 |
4-chloro-5-methoxy-2-pyridin-2-ylpyrimidine (CAS 321432-82-0) is a chemical compound with the molecular formula C10H8ClN3O and a molecular weight of 221.64 g/mol. IUPAC name: 4-chloro-5-methoxy-2-pyridin-2-ylpyrimidine. InChIKey: BTHRCJACYHBCHX-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 4-chloro-5-methoxy-2-pyridin-2-ylpyrimidine |
| InChIKey | BTHRCJACYHBCHX-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(N=C1Cl)C2=CC=CC=N2 |
Computed by PubChem (NCBI)