Products 36335-89-4
CAS 36335-89-4 is the registry number for 2-Chloro-4-methoxy-6-phenyl-1,3,5-triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-chloro-4-methoxy-6-phenyl-1,3,5-triazine (CAS 36335-89-4) is a chemical compound with the molecular formula C10H8ClN3O and a molecular weight of 221.64 g/mol. IUPAC name: 2-chloro-4-methoxy-6-phenyl-1,3,5-triazine. InChIKey: JYPBGEPRGFCZFB-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 2-chloro-4-methoxy-6-phenyl-1,3,5-triazine |
| InChIKey | JYPBGEPRGFCZFB-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=N1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)