cas: 1360953-02-1 — see every product listed under this CAS number, including other names
4-Chloro-5-methoxybenzimidazole, ≥95%, ≥95% (CAS 1360953-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUGN-100mg |
| cas | 1360953-02-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 952.40 Pln | |
| Chemat | 5g | 4955.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-chloro-5-methoxy-1H-benzimidazole (CAS 1360953-02-1) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 4-chloro-5-methoxy-1H-benzimidazole. InChIKey: VXELIBRJQFMUNW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 4-chloro-5-methoxy-1H-benzimidazole |
| InChIKey | VXELIBRJQFMUNW-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC=N2)Cl |
Computed by PubChem (NCBI)